C35H37N3O3 — CID 102342317
2-[4-(N-phenylanilino)phenoxy]ethyl (2E)-2-cyano-2-[3-[(E)-2-(dimethylamino)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]acetate (PubChem CID 102342317) has the molecular formula C35H37N3O3 and a molecular weight of 547.70 g/mol. Its IUPAC name is 2-[4-(N-phenylanilino)phenoxy]ethyl (2E)-2-cyano-2-[3-[(E)-2-(dimethylamino)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]acetate.
| Compound Name | 2-[4-(N-phenylanilino)phenoxy]ethyl (2E)-2-cyano-2-[3-[(E)-2-(dimethylamino)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]acetate |
|---|---|
| PubChem CID | 102342317 |
| Molecular Formula | C35H37N3O3 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 2-[4-(N-phenylanilino)phenoxy]ethyl (2E)-2-cyano-2-[3-[(E)-2-(dimethylamino)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]acetate |
| SMILES | CN(C)/C=C/C1=C/C(=C(\C#N)C(=O)OCCOc2ccc(N(c3ccccc3)c3ccccc3)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C35H37N3O3/c1-35(2)24-27(19-20-37(3)4)23-28(25-35)33(26-36)34(39)41-22-21-40-32-17-15-31(16-18-32)38(29-11-7-5-8-12-29)30-13-9-6-10-14-30/h5-20,23H,21-22,24-25H2,1-4H3/b20-19+,33-28- |
| InChIKey | SDNSGUYDFGBNPZ-SCECQGMGSA-N |
| XLogP | 7.72 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|