C42H34Cl2N2 — CID 102343359
(2S,3S)-2,3-bis(4-chlorophenyl)-5-(4-methylphenyl)-1,4,7-triphenyl-3,5-dihydro-2H-1,4-diazepine (PubChem CID 102343359) has the molecular formula C42H34Cl2N2 and a molecular weight of 637.65 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(4-chlorophenyl)-5-(4-methylphenyl)-1,4,7-triphenyl-3,5-dihydro-2H-1,4-diazepine.
| Compound Name | (2S,3S)-2,3-bis(4-chlorophenyl)-5-(4-methylphenyl)-1,4,7-triphenyl-3,5-dihydro-2H-1,4-diazepine |
|---|---|
| PubChem CID | 102343359 |
| Molecular Formula | C42H34Cl2N2 |
| Molecular Weight | 637.65 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | (2S,3S)-2,3-bis(4-chlorophenyl)-5-(4-methylphenyl)-1,4,7-triphenyl-3,5-dihydro-2H-1,4-diazepine |
| SMILES | Cc1ccc(C2C=C(c3ccccc3)N(c3ccccc3)[C@@H](c3ccc(Cl)cc3)[C@H](c3ccc(Cl)cc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C42H34Cl2N2/c1-30-17-19-32(20-18-30)40-29-39(31-11-5-2-6-12-31)45(37-13-7-3-8-14-37)41(33-21-25-35(43)26-22-33)42(34-23-27-36(44)28-24-34)46(40)38-15-9-4-10-16-38/h2-29,40-42H,1H3/t40?,41-,42-/m0/s1 |
| InChIKey | OXMBAZVJSHHICW-RPBSHQSZSA-N |
| XLogP | 11.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.65 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |