C26H35NO2 — CID 102347281
propan-2-yl 2-[[2-(4-tert-butylphenyl)piperidin-1-yl]methyl]benzoate (PubChem CID 102347281) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is propan-2-yl 2-[[2-(4-tert-butylphenyl)piperidin-1-yl]methyl]benzoate.
| Compound Name | propan-2-yl 2-[[2-(4-tert-butylphenyl)piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 102347281 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | propan-2-yl 2-[[2-(4-tert-butylphenyl)piperidin-1-yl]methyl]benzoate |
| SMILES | CC(C)OC(=O)c1ccccc1CN1CCCCC1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H35NO2/c1-19(2)29-25(28)23-11-7-6-10-21(23)18-27-17-9-8-12-24(27)20-13-15-22(16-14-20)26(3,4)5/h6-7,10-11,13-16,19,24H,8-9,12,17-18H2,1-5H3 |
| InChIKey | CWEGQFFTWPSPGV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |