C19H17Cl2NO — CID 102349087
(1R,3R,4R)-2,3-bis(4-chlorophenyl)-2-azabicyclo[2.2.2]octan-5-one (PubChem CID 102349087) has the molecular formula C19H17Cl2NO and a molecular weight of 346.26 g/mol. Its IUPAC name is (1R,3R,4R)-2,3-bis(4-chlorophenyl)-2-azabicyclo[2.2.2]octan-5-one.
| Compound Name | (1R,3R,4R)-2,3-bis(4-chlorophenyl)-2-azabicyclo[2.2.2]octan-5-one |
|---|---|
| PubChem CID | 102349087 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (1R,3R,4R)-2,3-bis(4-chlorophenyl)-2-azabicyclo[2.2.2]octan-5-one |
| SMILES | O=C1C[C@H]2CC[C@@H]1[C@H](c1ccc(Cl)cc1)N2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2NO/c20-13-3-1-12(2-4-13)19-17-10-9-16(11-18(17)23)22(19)15-7-5-14(21)6-8-15/h1-8,16-17,19H,9-11H2/t16-,17+,19+/m1/s1 |
| InChIKey | SBYRQHLRXQVQRA-AOIWGVFYSA-N |
| XLogP | 5.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |