C21H24N2O — CID 84612679
3-(4-aminophenyl)-2-(3,5-dimethylphenyl)-2-azabicyclo[2.2.2]octan-5-one (PubChem CID 84612679) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-(4-aminophenyl)-2-(3,5-dimethylphenyl)-2-azabicyclo[2.2.2]octan-5-one.
| Compound Name | 3-(4-aminophenyl)-2-(3,5-dimethylphenyl)-2-azabicyclo[2.2.2]octan-5-one |
|---|---|
| PubChem CID | 84612679 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 3-(4-aminophenyl)-2-(3,5-dimethylphenyl)-2-azabicyclo[2.2.2]octan-5-one |
| SMILES | Cc1cc(C)cc(N2C3CCC(C(=O)C3)C2c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C21H24N2O/c1-13-9-14(2)11-18(10-13)23-17-7-8-19(20(24)12-17)21(23)15-3-5-16(22)6-4-15/h3-6,9-11,17,19,21H,7-8,12,22H2,1-2H3 |
| InChIKey | PYOCCLDRCLCVCB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|