C19H18ClNO — CID 11404162
(1R,3R,4R)-3-(4-chlorophenyl)-2-phenyl-2-azabicyclo[2.2.2]octan-5-one (PubChem CID 11404162) has the molecular formula C19H18ClNO and a molecular weight of 311.81 g/mol. Its IUPAC name is (1R,3R,4R)-3-(4-chlorophenyl)-2-phenyl-2-azabicyclo[2.2.2]octan-5-one.
| Compound Name | (1R,3R,4R)-3-(4-chlorophenyl)-2-phenyl-2-azabicyclo[2.2.2]octan-5-one |
|---|---|
| PubChem CID | 11404162 |
| Molecular Formula | C19H18ClNO |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (1R,3R,4R)-3-(4-chlorophenyl)-2-phenyl-2-azabicyclo[2.2.2]octan-5-one |
| SMILES | O=C1C[C@H]2CC[C@@H]1[C@H](c1ccc(Cl)cc1)N2c1ccccc1 |
| InChI | InChI=1S/C19H18ClNO/c20-14-8-6-13(7-9-14)19-17-11-10-16(12-18(17)22)21(19)15-4-2-1-3-5-15/h1-9,16-17,19H,10-12H2/t16-,17+,19+/m1/s1 |
| InChIKey | DLROUQFDCILAFG-AOIWGVFYSA-N |
| XLogP | 4.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |