C19H19ClN2O — CID 84612651
3-(4-aminophenyl)-2-(4-chlorophenyl)-2-azabicyclo[2.2.2]octan-5-one (PubChem CID 84612651) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 3-(4-aminophenyl)-2-(4-chlorophenyl)-2-azabicyclo[2.2.2]octan-5-one.
| Compound Name | 3-(4-aminophenyl)-2-(4-chlorophenyl)-2-azabicyclo[2.2.2]octan-5-one |
|---|---|
| PubChem CID | 84612651 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-(4-aminophenyl)-2-(4-chlorophenyl)-2-azabicyclo[2.2.2]octan-5-one |
| SMILES | Nc1ccc(C2C3CCC(CC3=O)N2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H19ClN2O/c20-13-3-7-15(8-4-13)22-16-9-10-17(18(23)11-16)19(22)12-1-5-14(21)6-2-12/h1-8,16-17,19H,9-11,21H2 |
| InChIKey | DHQBYUPYVRTKSC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|