C19H19NO2 — CID 53342321
(1S,3R,4S)-3-(4-hydroxyphenyl)-2-phenyl-2-azabicyclo[2.2.2]octan-5-one (PubChem CID 53342321) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (1S,3R,4S)-3-(4-hydroxyphenyl)-2-phenyl-2-azabicyclo[2.2.2]octan-5-one.
| Compound Name | (1S,3R,4S)-3-(4-hydroxyphenyl)-2-phenyl-2-azabicyclo[2.2.2]octan-5-one |
|---|---|
| PubChem CID | 53342321 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (1S,3R,4S)-3-(4-hydroxyphenyl)-2-phenyl-2-azabicyclo[2.2.2]octan-5-one |
| SMILES | O=C1C[C@@H]2CC[C@H]1[C@H](c1ccc(O)cc1)N2c1ccccc1 |
| InChI | InChI=1S/C19H19NO2/c21-16-9-6-13(7-10-16)19-17-11-8-15(12-18(17)22)20(19)14-4-2-1-3-5-14/h1-7,9-10,15,17,19,21H,8,11-12H2/t15-,17+,19-/m0/s1 |
| InChIKey | AYZRVYBDYAIZDL-WDYCEAGBSA-N |
| XLogP | 3.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |