C19H31NO3S — CID 102354692
O-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]non-3-ynyl] pyrrolidine-1-carbothioate (PubChem CID 102354692) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is O-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]non-3-ynyl] pyrrolidine-1-carbothioate.
| Compound Name | O-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]non-3-ynyl] pyrrolidine-1-carbothioate |
|---|---|
| PubChem CID | 102354692 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | O-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]non-3-ynyl] pyrrolidine-1-carbothioate |
| SMILES | CCCCCC#CC[C@H](OC(=S)N1CCCC1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H31NO3S/c1-4-5-6-7-8-9-12-16(17-15-21-19(2,3)23-17)22-18(24)20-13-10-11-14-20/h16-17H,4-7,10-15H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | SWFSVFLIHUQTNA-DLBZAZTESA-N |
| XLogP | 3.88 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|