C16H20I2O5 — CID 102355419
2-[2-(2-methoxyethoxy)ethoxy]ethyl (E)-3-(3,5-diiodophenyl)prop-2-enoate (PubChem CID 102355419) has the molecular formula C16H20I2O5 and a molecular weight of 546.14 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl (E)-3-(3,5-diiodophenyl)prop-2-enoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl (E)-3-(3,5-diiodophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 102355419 |
| Molecular Formula | C16H20I2O5 |
| Molecular Weight | 546.14 g/mol |
| Exact Mass | 545.94 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl (E)-3-(3,5-diiodophenyl)prop-2-enoate |
| SMILES | COCCOCCOCCOC(=O)/C=C/c1cc(I)cc(I)c1 |
| InChI | InChI=1S/C16H20I2O5/c1-20-4-5-21-6-7-22-8-9-23-16(19)3-2-13-10-14(17)12-15(18)11-13/h2-3,10-12H,4-9H2,1H3/b3-2+ |
| InChIKey | UIAJNLLFWGYUSY-NSCUHMNNSA-N |
| XLogP | 3.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|