C13H13F2N3O3 — CID 170375790
3-methoxypropyl (E)-3-(4-azido-3,5-difluorophenyl)prop-2-enoate (PubChem CID 170375790) has the molecular formula C13H13F2N3O3 and a molecular weight of 297.26 g/mol. Its IUPAC name is 3-methoxypropyl (E)-3-(4-azido-3,5-difluorophenyl)prop-2-enoate.
| Compound Name | 3-methoxypropyl (E)-3-(4-azido-3,5-difluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 170375790 |
| Molecular Formula | C13H13F2N3O3 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-methoxypropyl (E)-3-(4-azido-3,5-difluorophenyl)prop-2-enoate |
| SMILES | COCCCOC(=O)/C=C/c1cc(F)c(N=[N+]=[N-])c(F)c1 |
| InChI | InChI=1S/C13H13F2N3O3/c1-20-5-2-6-21-12(19)4-3-9-7-10(14)13(17-18-16)11(15)8-9/h3-4,7-8H,2,5-6H2,1H3/b4-3+ |
| InChIKey | UBIYIRAZMCCGKC-ONEGZZNKSA-N |
| XLogP | 3.50 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|