C15H14F2O4 — CID 70288420
3-prop-2-enoyloxypropyl (E)-3-(3,5-difluorophenyl)prop-2-enoate (PubChem CID 70288420) has the molecular formula C15H14F2O4 and a molecular weight of 296.27 g/mol. Its IUPAC name is 3-prop-2-enoyloxypropyl (E)-3-(3,5-difluorophenyl)prop-2-enoate.
| Compound Name | 3-prop-2-enoyloxypropyl (E)-3-(3,5-difluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 70288420 |
| Molecular Formula | C15H14F2O4 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-prop-2-enoyloxypropyl (E)-3-(3,5-difluorophenyl)prop-2-enoate |
| SMILES | C=CC(=O)OCCCOC(=O)/C=C/c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H14F2O4/c1-2-14(18)20-6-3-7-21-15(19)5-4-11-8-12(16)10-13(17)9-11/h2,4-5,8-10H,1,3,6-7H2/b5-4+ |
| InChIKey | KFOSJCAJNYXNSX-SNAWJCMRSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|