C16H28O2 — CID 102356663
(2R,3R)-2,8,8-trimethyl-3-(3-methylbut-2-enyl)-7,9-dioxaspiro[4.5]decane (PubChem CID 102356663) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (2R,3R)-2,8,8-trimethyl-3-(3-methylbut-2-enyl)-7,9-dioxaspiro[4.5]decane.
| Compound Name | (2R,3R)-2,8,8-trimethyl-3-(3-methylbut-2-enyl)-7,9-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 102356663 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (2R,3R)-2,8,8-trimethyl-3-(3-methylbut-2-enyl)-7,9-dioxaspiro[4.5]decane |
| SMILES | CC(C)=CC[C@@H]1CC2(COC(C)(C)OC2)C[C@H]1C |
| InChI | InChI=1S/C16H28O2/c1-12(2)6-7-14-9-16(8-13(14)3)10-17-15(4,5)18-11-16/h6,13-14H,7-11H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | OHJOHUIFTSASJA-ZIAGYGMSSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|