C23H24ClN5O3 — CID 102358283
methyl 1-(4-chlorophenyl)-4-[4-(4-methylpiperazin-1-yl)anilino]-6-oxopyridazine-3-carboxylate (PubChem CID 102358283) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is methyl 1-(4-chlorophenyl)-4-[4-(4-methylpiperazin-1-yl)anilino]-6-oxopyridazine-3-carboxylate.
| Compound Name | methyl 1-(4-chlorophenyl)-4-[4-(4-methylpiperazin-1-yl)anilino]-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 102358283 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | methyl 1-(4-chlorophenyl)-4-[4-(4-methylpiperazin-1-yl)anilino]-6-oxopyridazine-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2ccc(Cl)cc2)c(=O)cc1Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C23H24ClN5O3/c1-27-11-13-28(14-12-27)18-9-5-17(6-10-18)25-20-15-21(30)29(26-22(20)23(31)32-2)19-7-3-16(24)4-8-19/h3-10,15,25H,11-14H2,1-2H3 |
| InChIKey | NAHQVDLHXZALOJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|