C18H20ClN5O3 — CID 169085557
methyl 5-chloro-2-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]pyrimidine-4-carboxylate (PubChem CID 169085557) has the molecular formula C18H20ClN5O3 and a molecular weight of 389.84 g/mol. Its IUPAC name is methyl 5-chloro-2-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]pyrimidine-4-carboxylate.
| Compound Name | methyl 5-chloro-2-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 169085557 |
| Molecular Formula | C18H20ClN5O3 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | methyl 5-chloro-2-[[4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)ncc1Cl |
| InChI | InChI=1S/C18H20ClN5O3/c1-23-7-9-24(10-8-23)13-5-3-12(4-6-13)21-17(25)16-20-11-14(19)15(22-16)18(26)27-2/h3-6,11H,7-10H2,1-2H3,(H,21,25) |
| InChIKey | MMLFTMVIFAWRPJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|