C24H24ClN7O — CID 172834296
1-(4-chlorophenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]-5-(1,2,4-triazol-1-yl)pyridin-2-one (PubChem CID 172834296) has the molecular formula C24H24ClN7O and a molecular weight of 461.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]-5-(1,2,4-triazol-1-yl)pyridin-2-one.
| Compound Name | 1-(4-chlorophenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]-5-(1,2,4-triazol-1-yl)pyridin-2-one |
|---|---|
| PubChem CID | 172834296 |
| Molecular Formula | C24H24ClN7O |
| Molecular Weight | 461.96 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-(4-methylpiperazin-1-yl)anilino]-5-(1,2,4-triazol-1-yl)pyridin-2-one |
| SMILES | CN1CCN(c2ccc(Nc3cc(-n4cncn4)cn(-c4ccc(Cl)cc4)c3=O)cc2)CC1 |
| InChI | InChI=1S/C24H24ClN7O/c1-29-10-12-30(13-11-29)20-8-4-19(5-9-20)28-23-14-22(32-17-26-16-27-32)15-31(24(23)33)21-6-2-18(25)3-7-21/h2-9,14-17,28H,10-13H2,1H3 |
| InChIKey | VYCYDZFRDOWCLY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.96 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|