C30H50N2O6SSi2 — CID 102361231
(2R,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-10-(phenylsulfanylmethyl)-3-oxa-1,12-diazatricyclo[7.4.0.02,6]tridecane-11,13-dione (PubChem CID 102361231) has the molecular formula C30H50N2O6SSi2 and a molecular weight of 622.98 g/mol. Its IUPAC name is (2R,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-10-(phenylsulfanylmethyl)-3-oxa-1,12-diazatricyclo[7.4.0.02,6]tridecane-11,13-dione.
| Compound Name | (2R,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-10-(phenylsulfanylmethyl)-3-oxa-1,12-diazatricyclo[7.4.0.02,6]tridecane-11,13-dione |
|---|---|
| PubChem CID | 102361231 |
| Molecular Formula | C30H50N2O6SSi2 |
| Molecular Weight | 622.98 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | (2R,4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-10-(phenylsulfanylmethyl)-3-oxa-1,12-diazatricyclo[7.4.0.02,6]tridecane-11,13-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H]2[C@@H](CC(O)C3C(CSc4ccccc4)C(=O)NC(=O)N32)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H50N2O6SSi2/c1-29(2,3)40(7,8)36-17-23-25(38-41(9,10)30(4,5)6)20-16-22(33)24-21(18-39-19-14-12-11-13-15-19)26(34)31-28(35)32(24)27(20)37-23/h11-15,20-25,27,33H,16-18H2,1-10H3,(H,31,34,35)/t20-,21?,22?,23+,24?,25-,27+/m0/s1 |
| InChIKey | NKIREAWAQICHNW-JLNPPHOFSA-N |
| XLogP | 5.83 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.98 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|