C30H22N4 — CID 102362915
2-phenyl-4,6-bis(5-phenyl-1H-pyrrol-2-yl)pyrimidine (PubChem CID 102362915) has the molecular formula C30H22N4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-phenyl-4,6-bis(5-phenyl-1H-pyrrol-2-yl)pyrimidine.
| Compound Name | 2-phenyl-4,6-bis(5-phenyl-1H-pyrrol-2-yl)pyrimidine |
|---|---|
| PubChem CID | 102362915 |
| Molecular Formula | C30H22N4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-phenyl-4,6-bis(5-phenyl-1H-pyrrol-2-yl)pyrimidine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4ccccc4)[nH]3)cc(-c3ccc(-c4ccccc4)[nH]3)n2)cc1 |
| InChI | InChI=1S/C30H22N4/c1-4-10-21(11-5-1)24-16-18-26(31-24)28-20-29(34-30(33-28)23-14-8-3-9-15-23)27-19-17-25(32-27)22-12-6-2-7-13-22/h1-20,31-32H |
| InChIKey | HGQCXSHHSWHTBB-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |