C11H18N2O2S2 — CID 102369851
S-[(1E,3Z)-2-(dimethylcarbamoylsulfanyl)penta-1,3-dienyl] N,N-dimethylcarbamothioate (PubChem CID 102369851) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is S-[(1E,3Z)-2-(dimethylcarbamoylsulfanyl)penta-1,3-dienyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[(1E,3Z)-2-(dimethylcarbamoylsulfanyl)penta-1,3-dienyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 102369851 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | S-[(1E,3Z)-2-(dimethylcarbamoylsulfanyl)penta-1,3-dienyl] N,N-dimethylcarbamothioate |
| SMILES | C/C=C\C(=C/SC(=O)N(C)C)SC(=O)N(C)C |
| InChI | InChI=1S/C11H18N2O2S2/c1-6-7-9(17-11(15)13(4)5)8-16-10(14)12(2)3/h6-8H,1-5H3/b7-6-,9-8+ |
| InChIKey | DZPCETQSYJVRJW-NMMTYZSQSA-N |
| XLogP | 3.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|