C5H9NOS — CID 71324085
S-ethenyl N,N-dimethylcarbamothioate (PubChem CID 71324085) has the molecular formula C5H9NOS and a molecular weight of 131.20 g/mol. Its IUPAC name is S-ethenyl N,N-dimethylcarbamothioate.
| Compound Name | S-ethenyl N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 71324085 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | S-ethenyl N,N-dimethylcarbamothioate |
| SMILES | C=CSC(=O)N(C)C |
| InChI | InChI=1S/C5H9NOS/c1-4-8-5(7)6(2)3/h4H,1H2,2-3H3 |
| InChIKey | ANLONEAZXUZJIP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|