About ethenyl 3-oxobutanedithioate
ethenyl 3-oxobutanedithioate (PubChem CID 101104413) has the molecular formula C6H8OS2
and a molecular weight of 160.26 g/mol. Its IUPAC name is ethenyl 3-oxobutanedithioate.
Molecular Properties
| Compound Name | ethenyl 3-oxobutanedithioate |
| PubChem CID | 101104413 |
| Molecular Formula | C6H8OS2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | ethenyl 3-oxobutanedithioate |
| SMILES | C=CSC(=S)CC(C)=O |
| InChI | InChI=1S/C6H8OS2/c1-3-9-6(8)4-5(2)7/h3H,1,4H2,2H3 |
| InChIKey | AUGHIVFEKYUUKY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 3-oxobutanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 3-oxobutanedithioate?
The IUPAC name of ethenyl 3-oxobutanedithioate (CID 101104413) is ethenyl 3-oxobutanedithioate.
What is the SMILES notation for ethenyl 3-oxobutanedithioate?
The canonical SMILES for ethenyl 3-oxobutanedithioate is C=CSC(=S)CC(C)=O.
What is the InChIKey of ethenyl 3-oxobutanedithioate?
The InChIKey is AUGHIVFEKYUUKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OS2/c1-3-9-6(8)4-5(2)7/h3H,1,4H2,2H3.
What are the key properties of ethenyl 3-oxobutanedithioate?
ethenyl 3-oxobutanedithioate has a molecular weight of 160.26 g/mol, XLogP of 2.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 3-oxobutanedithioate is sourced from PubChem (CID 101104413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).