C29H40N2OPS+ — CID 102370871
[1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-2-propan-2-ylsulfanylpropyl]-[2-(methoxymethyl)pyrrolidin-1-yl]azanium (PubChem CID 102370871) has the molecular formula C29H40N2OPS+ and a molecular weight of 495.69 g/mol. Its IUPAC name is [1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-2-propan-2-ylsulfanylpropyl]-[2-(methoxymethyl)pyrrolidin-1-yl]azanium.
| Compound Name | [1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-2-propan-2-ylsulfanylpropyl]-[2-(methoxymethyl)pyrrolidin-1-yl]azanium |
|---|---|
| PubChem CID | 102370871 |
| Molecular Formula | C29H40N2OPS+ |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | [1-(2-diphenylphosphanylcyclopenta-1,4-dien-1-yl)-2-propan-2-ylsulfanylpropyl]-[2-(methoxymethyl)pyrrolidin-1-yl]azanium |
| SMILES | COCC1CCCN1[NH2+]C(C1=C(P(c2ccccc2)c2ccccc2)CC=C1)C(C)SC(C)C |
| InChI | InChI=1S/C29H39N2OPS/c1-22(2)34-23(3)29(30-31-20-12-13-24(31)21-32-4)27-18-11-19-28(27)33(25-14-7-5-8-15-25)26-16-9-6-10-17-26/h5-11,14-18,22-24,29-30H,12-13,19-21H2,1-4H3/p+1 |
| InChIKey | MOCWQWIVJHUNNV-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 29.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|