C20H27BO6 — CID 102378912
ditert-butyl (4R,5R)-2-[(E)-2-phenylethenyl]-1,3,2-dioxaborolane-4,5-dicarboxylate (PubChem CID 102378912) has the molecular formula C20H27BO6 and a molecular weight of 374.24 g/mol. Its IUPAC name is ditert-butyl (4R,5R)-2-[(E)-2-phenylethenyl]-1,3,2-dioxaborolane-4,5-dicarboxylate.
| Compound Name | ditert-butyl (4R,5R)-2-[(E)-2-phenylethenyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 102378912 |
| Molecular Formula | C20H27BO6 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | ditert-butyl (4R,5R)-2-[(E)-2-phenylethenyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1OB(/C=C/c2ccccc2)O[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27BO6/c1-19(2,3)24-17(22)15-16(18(23)25-20(4,5)6)27-21(26-15)13-12-14-10-8-7-9-11-14/h7-13,15-16H,1-6H3/b13-12+/t15-,16-/m1/s1 |
| InChIKey | PBGMPBHXGRNHED-ZTMCPOQVSA-N |
| XLogP | 3.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|