C21H38O8Si — CID 102385085
methyl 2-[(1S,3R,8S,10R,12S,13R,14R)-6,6-ditert-butyl-13,14-dihydroxy-13-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate (PubChem CID 102385085) has the molecular formula C21H38O8Si and a molecular weight of 446.61 g/mol. Its IUPAC name is methyl 2-[(1S,3R,8S,10R,12S,13R,14R)-6,6-ditert-butyl-13,14-dihydroxy-13-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate.
| Compound Name | methyl 2-[(1S,3R,8S,10R,12S,13R,14R)-6,6-ditert-butyl-13,14-dihydroxy-13-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate |
|---|---|
| PubChem CID | 102385085 |
| Molecular Formula | C21H38O8Si |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | methyl 2-[(1S,3R,8S,10R,12S,13R,14R)-6,6-ditert-butyl-13,14-dihydroxy-13-methyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@@H]2C[C@@H]3O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]3O[C@H]2[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C21H38O8Si/c1-19(2,3)30(20(4,5)6)26-11-14-12(29-30)9-13-17(28-14)18(23)21(7,24)15(27-13)10-16(22)25-8/h12-15,17-18,23-24H,9-11H2,1-8H3/t12-,13+,14+,15-,17+,18+,21-/m0/s1 |
| InChIKey | WEKNKOBRCYLCLJ-NTMXHQGVSA-N |
| XLogP | 2.04 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|