C19H28O3 — CID 102390366
(3S)-3-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-5,5-dimethylhexane-2,4-dione (PubChem CID 102390366) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (3S)-3-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-5,5-dimethylhexane-2,4-dione.
| Compound Name | (3S)-3-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-5,5-dimethylhexane-2,4-dione |
|---|---|
| PubChem CID | 102390366 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (3S)-3-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]-5,5-dimethylhexane-2,4-dione |
| SMILES | COc1ccc([C@H](C(C)C)[C@@H](C(C)=O)C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H28O3/c1-12(2)16(14-8-10-15(22-7)11-9-14)17(13(3)20)18(21)19(4,5)6/h8-12,16-17H,1-7H3/t16-,17+/m0/s1 |
| InChIKey | GIRJQNFGJOXUIB-DLBZAZTESA-N |
| XLogP | 4.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|