C21H21FO2 — CID 102394954
(1R,2S,12S,16S)-10-(4-fluorophenyl)-11-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-7,9-dien-3-one (PubChem CID 102394954) has the molecular formula C21H21FO2 and a molecular weight of 324.39 g/mol. Its IUPAC name is (1R,2S,12S,16S)-10-(4-fluorophenyl)-11-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-7,9-dien-3-one.
| Compound Name | (1R,2S,12S,16S)-10-(4-fluorophenyl)-11-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-7,9-dien-3-one |
|---|---|
| PubChem CID | 102394954 |
| Molecular Formula | C21H21FO2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (1R,2S,12S,16S)-10-(4-fluorophenyl)-11-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-7,9-dien-3-one |
| SMILES | O=C1CCCC2=CC3=C(c4ccc(F)cc4)O[C@H]4CCC[C@@H]([C@H]12)[C@@H]34 |
| InChI | InChI=1S/C21H21FO2/c22-14-9-7-12(8-10-14)21-16-11-13-3-1-5-17(23)19(13)15-4-2-6-18(24-21)20(15)16/h7-11,15,18-20H,1-6H2/t15-,18-,19+,20-/m0/s1 |
| InChIKey | IBUNVHJSWNFXMI-QLIIJSOBSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |