C33H26Cl2N2O3 — CID 102396798
2-(2-tert-butyl-1H-indol-3-yl)-3,6-dichloro-5-(5-phenylmethoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 102396798) has the molecular formula C33H26Cl2N2O3 and a molecular weight of 569.49 g/mol. Its IUPAC name is 2-(2-tert-butyl-1H-indol-3-yl)-3,6-dichloro-5-(5-phenylmethoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(2-tert-butyl-1H-indol-3-yl)-3,6-dichloro-5-(5-phenylmethoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 102396798 |
| Molecular Formula | C33H26Cl2N2O3 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 2-(2-tert-butyl-1H-indol-3-yl)-3,6-dichloro-5-(5-phenylmethoxy-1H-indol-3-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(C)c1[nH]c2ccccc2c1C1=C(Cl)C(=O)C(c2c[nH]c3ccc(OCc4ccccc4)cc23)=C(Cl)C1=O |
| InChI | InChI=1S/C33H26Cl2N2O3/c1-33(2,3)32-25(20-11-7-8-12-24(20)37-32)27-29(35)30(38)26(28(34)31(27)39)22-16-36-23-14-13-19(15-21(22)23)40-17-18-9-5-4-6-10-18/h4-16,36-37H,17H2,1-3H3 |
| InChIKey | LGXQFRLCXYYWQT-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|