C19H21NO4 — CID 102400026
(1Z,2R)-1-[(1S)-2-hydroxy-1-phenylethoxy]imino-1-(4-methoxyphenyl)but-3-en-2-ol (PubChem CID 102400026) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (1Z,2R)-1-[(1S)-2-hydroxy-1-phenylethoxy]imino-1-(4-methoxyphenyl)but-3-en-2-ol.
| Compound Name | (1Z,2R)-1-[(1S)-2-hydroxy-1-phenylethoxy]imino-1-(4-methoxyphenyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 102400026 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (1Z,2R)-1-[(1S)-2-hydroxy-1-phenylethoxy]imino-1-(4-methoxyphenyl)but-3-en-2-ol |
| SMILES | C=C[C@@H](O)/C(=N\O[C@H](CO)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H21NO4/c1-3-17(22)19(15-9-11-16(23-2)12-10-15)20-24-18(13-21)14-7-5-4-6-8-14/h3-12,17-18,21-22H,1,13H2,2H3/b20-19-/t17-,18-/m1/s1 |
| InChIKey | QZWLSGFLJRGCMC-CIZKTZFGSA-N |
| XLogP | 2.70 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|