C25H30O6 — CID 102401392
(5R,6E,8S)-5,8-bis[(4-methoxyphenyl)methoxy]-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 102401392) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is (5R,6E,8S)-5,8-bis[(4-methoxyphenyl)methoxy]-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (5R,6E,8S)-5,8-bis[(4-methoxyphenyl)methoxy]-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 102401392 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (5R,6E,8S)-5,8-bis[(4-methoxyphenyl)methoxy]-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | COc1ccc(CO[C@@H]2/C=C/[C@H](OCc3ccc(OC)cc3)CCCOC(=O)C2)cc1 |
| InChI | InChI=1S/C25H30O6/c1-27-21-9-5-19(6-10-21)17-30-23-4-3-15-29-25(26)16-24(14-13-23)31-18-20-7-11-22(28-2)12-8-20/h5-14,23-24H,3-4,15-18H2,1-2H3/b14-13+/t23-,24-/m1/s1 |
| InChIKey | USJIWNZEINTKRV-IDSBPIFPSA-N |
| XLogP | 4.46 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|