C31H32O16 — CID 102404034
(1S,3R,4R,5R)-3-(4-carboxy-3-hydroxy-3-methylbutanoyl)oxy-4,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1-hydroxycyclohexane-1-carboxylic acid (PubChem CID 102404034) has the molecular formula C31H32O16 and a molecular weight of 660.58 g/mol. Its IUPAC name is (1S,3R,4R,5R)-3-(4-carboxy-3-hydroxy-3-methylbutanoyl)oxy-4,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5R)-3-(4-carboxy-3-hydroxy-3-methylbutanoyl)oxy-4,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 102404034 |
| Molecular Formula | C31H32O16 |
| Molecular Weight | 660.58 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | (1S,3R,4R,5R)-3-(4-carboxy-3-hydroxy-3-methylbutanoyl)oxy-4,5-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1-hydroxycyclohexane-1-carboxylic acid |
| SMILES | CC(O)(CC(=O)O)CC(=O)O[C@@H]1C[C@@](O)(C(=O)O)C[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@@H]1OC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C31H32O16/c1-30(43,14-24(36)37)15-27(40)46-23-13-31(44,29(41)42)12-22(45-25(38)8-4-16-2-6-18(32)20(34)10-16)28(23)47-26(39)9-5-17-3-7-19(33)21(35)11-17/h2-11,22-23,28,32-35,43-44H,12-15H2,1H3,(H,36,37)(H,41,42)/b8-4+,9-5+/t22-,23-,28+,30?,31-/m1/s1 |
| InChIKey | BEKYZOSRHNMGCR-FMZRLEOLSA-N |
| XLogP | 1.20 |
| TPSA | 274.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.58 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|