C12H20O2 — CID 102405006
[(3E)-hepta-1,3-dien-2-yl] 2,2-dimethylpropanoate (PubChem CID 102405006) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is [(3E)-hepta-1,3-dien-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3E)-hepta-1,3-dien-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102405006 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | [(3E)-hepta-1,3-dien-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(/C=C/CCC)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H20O2/c1-6-7-8-9-10(2)14-11(13)12(3,4)5/h8-9H,2,6-7H2,1,3-5H3/b9-8+ |
| InChIKey | NFHXZFUAHNCMFB-CMDGGOBGSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|