C33H34N6O2 — CID 102405121
4,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2-methylbenzene-1,3-diol (PubChem CID 102405121) has the molecular formula C33H34N6O2 and a molecular weight of 546.68 g/mol. Its IUPAC name is 4,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2-methylbenzene-1,3-diol.
| Compound Name | 4,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 102405121 |
| Molecular Formula | C33H34N6O2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 4,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2-methylbenzene-1,3-diol |
| SMILES | Cc1c(O)c(CN(Cc2ccccn2)Cc2ccccn2)cc(CN(Cc2ccccn2)Cc2ccccn2)c1O |
| InChI | InChI=1S/C33H34N6O2/c1-25-32(40)26(19-38(21-28-10-2-6-14-34-28)22-29-11-3-7-15-35-29)18-27(33(25)41)20-39(23-30-12-4-8-16-36-30)24-31-13-5-9-17-37-31/h2-18,40-41H,19-24H2,1H3 |
| InChIKey | VWUXMDHQJSBJGI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|