C14H22OSi — CID 102407701
trimethyl-[(6Z,8E)-5-methyl-1,3,4,5-tetrahydrocycloocta[c]furan-9-yl]silane (PubChem CID 102407701) has the molecular formula C14H22OSi and a molecular weight of 234.41 g/mol. Its IUPAC name is trimethyl-[(6Z,8E)-5-methyl-1,3,4,5-tetrahydrocycloocta[c]furan-9-yl]silane.
| Compound Name | trimethyl-[(6Z,8E)-5-methyl-1,3,4,5-tetrahydrocycloocta[c]furan-9-yl]silane |
|---|---|
| PubChem CID | 102407701 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | trimethyl-[(6Z,8E)-5-methyl-1,3,4,5-tetrahydrocycloocta[c]furan-9-yl]silane |
| SMILES | CC1/C=C\C=C(\[Si](C)(C)C)C2=C(COC2)C1 |
| InChI | InChI=1S/C14H22OSi/c1-11-6-5-7-14(16(2,3)4)13-10-15-9-12(13)8-11/h5-7,11H,8-10H2,1-4H3/b6-5-,14-7+ |
| InChIKey | RGTXVVIWVAZKPM-NTBKVEBNSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|