C26H46O2Si — CID 102407713
tert-butyl-dimethyl-[(1S,6R)-3-methyl-6-[(E,2S)-4-[(1R,2S,3S,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-3-en-2-yl]cyclohex-2-en-1-yl]oxysilane (PubChem CID 102407713) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,6R)-3-methyl-6-[(E,2S)-4-[(1R,2S,3S,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-3-en-2-yl]cyclohex-2-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S,6R)-3-methyl-6-[(E,2S)-4-[(1R,2S,3S,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-3-en-2-yl]cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 102407713 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,6R)-3-methyl-6-[(E,2S)-4-[(1R,2S,3S,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-3-en-2-yl]cyclohex-2-en-1-yl]oxysilane |
| SMILES | CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]([C@@H](C)/C=C/[C@H]2[C@H](C)[C@]3(C)CC[C@@]2(C)O3)CC1 |
| InChI | InChI=1S/C26H46O2Si/c1-18-11-13-21(23(17-18)27-29(9,10)24(4,5)6)19(2)12-14-22-20(3)25(7)15-16-26(22,8)28-25/h12,14,17,19-23H,11,13,15-16H2,1-10H3/b14-12+/t19-,20-,21+,22-,23+,25-,26+/m0/s1 |
| InChIKey | LSGKMJDNNUGZIM-XFHURALMSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|