C13H12O5 — CID 102410271
(1S,3R,4R)-1,4,8-trihydroxyspiro[2,4-dihydro-1H-naphthalene-3,5'-furan]-2'-one (PubChem CID 102410271) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is (1S,3R,4R)-1,4,8-trihydroxyspiro[2,4-dihydro-1H-naphthalene-3,5'-furan]-2'-one.
| Compound Name | (1S,3R,4R)-1,4,8-trihydroxyspiro[2,4-dihydro-1H-naphthalene-3,5'-furan]-2'-one |
|---|---|
| PubChem CID | 102410271 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (1S,3R,4R)-1,4,8-trihydroxyspiro[2,4-dihydro-1H-naphthalene-3,5'-furan]-2'-one |
| SMILES | O=C1C=C[C@@]2(C[C@H](O)c3c(O)cccc3[C@H]2O)O1 |
| InChI | InChI=1S/C13H12O5/c14-8-3-1-2-7-11(8)9(15)6-13(12(7)17)5-4-10(16)18-13/h1-5,9,12,14-15,17H,6H2/t9-,12+,13-/m0/s1 |
| InChIKey | DMTBRKVDYZXKSL-BIMULSAOSA-N |
| XLogP | 0.71 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |