C14H14O5 — CID 24970871
(1R,3R,4R)-1,4,8-trihydroxy-3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-furan]-2'-one (PubChem CID 24970871) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is (1R,3R,4R)-1,4,8-trihydroxy-3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-furan]-2'-one.
| Compound Name | (1R,3R,4R)-1,4,8-trihydroxy-3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-furan]-2'-one |
|---|---|
| PubChem CID | 24970871 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (1R,3R,4R)-1,4,8-trihydroxy-3'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-furan]-2'-one |
| SMILES | CC1=C[C@@]2(C[C@@H](O)c3c(O)cccc3[C@H]2O)OC1=O |
| InChI | InChI=1S/C14H14O5/c1-7-5-14(19-13(7)18)6-10(16)11-8(12(14)17)3-2-4-9(11)15/h2-5,10,12,15-17H,6H2,1H3/t10-,12-,14+/m1/s1 |
| InChIKey | YGLRNYJGBGOMKF-QKCSRTOESA-N |
| XLogP | 1.10 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |