C14H20N2 — CID 102411236
2-[(1R,2R)-5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl]propanedinitrile (PubChem CID 102411236) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-[(1R,2R)-5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl]propanedinitrile.
| Compound Name | 2-[(1R,2R)-5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl]propanedinitrile |
|---|---|
| PubChem CID | 102411236 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-[(1R,2R)-5,5-dimethyl-2-prop-1-en-2-ylcyclohexyl]propanedinitrile |
| SMILES | C=C(C)[C@@H]1CCC(C)(C)C[C@H]1C(C#N)C#N |
| InChI | InChI=1S/C14H20N2/c1-10(2)12-5-6-14(3,4)7-13(12)11(8-15)9-16/h11-13H,1,5-7H2,2-4H3/t12-,13-/m0/s1 |
| InChIKey | RMAREPNLKCUDHY-STQMWFEESA-N |
| XLogP | 3.67 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|