C14H16O5 — CID 102412051
[(2R,3S,3aR,7aS)-2-ethenyl-5-oxo-6-prop-1-en-2-yl-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl] acetate (PubChem CID 102412051) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is [(2R,3S,3aR,7aS)-2-ethenyl-5-oxo-6-prop-1-en-2-yl-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl] acetate.
| Compound Name | [(2R,3S,3aR,7aS)-2-ethenyl-5-oxo-6-prop-1-en-2-yl-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl] acetate |
|---|---|
| PubChem CID | 102412051 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [(2R,3S,3aR,7aS)-2-ethenyl-5-oxo-6-prop-1-en-2-yl-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl] acetate |
| SMILES | C=C[C@H]1O[C@H]2C=C(C(=C)C)C(=O)O[C@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H16O5/c1-5-10-12(17-8(4)15)13-11(18-10)6-9(7(2)3)14(16)19-13/h5-6,10-13H,1-2H2,3-4H3/t10-,11+,12+,13-/m1/s1 |
| InChIKey | YKGXKJXKMWFIJX-MROQNXINSA-N |
| XLogP | 1.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|