C44H61NO6Si — CID 102412224
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)-2-(phenylmethoxymethyl)hex-3-enoate (PubChem CID 102412224) has the molecular formula C44H61NO6Si and a molecular weight of 728.06 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)-2-(phenylmethoxymethyl)hex-3-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)-2-(phenylmethoxymethyl)hex-3-enoate |
|---|---|
| PubChem CID | 102412224 |
| Molecular Formula | C44H61NO6Si |
| Molecular Weight | 728.06 g/mol |
| Exact Mass | 727.43 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxycarbonylamino)-2-(phenylmethoxymethyl)hex-3-enoate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)[C@@](/C=C/CCO[Si](C)(C)C(C)(C)C)(COCc2ccccc2)NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C44H61NO6Si/c1-34-26-27-38(43(5,6)37-24-16-11-17-25-37)39(30-34)51-40(46)44(33-48-31-35-20-12-9-13-21-35,28-18-19-29-50-52(7,8)42(2,3)4)45-41(47)49-32-36-22-14-10-15-23-36/h9-18,20-25,28,34,38-39H,19,26-27,29-33H2,1-8H3,(H,45,47)/b28-18+/t34-,38-,39-,44-/m1/s1 |
| InChIKey | WLHBKONKFDXINW-FANSFAIVSA-N |
| XLogP | 10.16 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.06 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|