C14H20O2 — CID 102413140
methyl (1R,4R,7R)-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxylate (PubChem CID 102413140) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is methyl (1R,4R,7R)-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxylate.
| Compound Name | methyl (1R,4R,7R)-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxylate |
|---|---|
| PubChem CID | 102413140 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | methyl (1R,4R,7R)-5-methyl-7-propan-2-ylbicyclo[2.2.2]octa-2,5-diene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C[C@H](C(C)C)[C@@H]1C=C2C |
| InChI | InChI=1S/C14H20O2/c1-8(2)11-6-10-7-13(14(15)16-4)12(11)5-9(10)3/h5,7-8,10-12H,6H2,1-4H3/t10-,11-,12+/m1/s1 |
| InChIKey | XXWNXVWBXHANAZ-UTUOFQBUSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|