C69H82N2O12 — CID 102413908
bis[6-[2-[6-[4-(4-cyanophenyl)phenoxy]hexoxy]phenoxy]hexyl] (3S)-3-methylhexanediperoxoate (PubChem CID 102413908) has the molecular formula C69H82N2O12 and a molecular weight of 1131.42 g/mol. Its IUPAC name is bis[6-[2-[6-[4-(4-cyanophenyl)phenoxy]hexoxy]phenoxy]hexyl] (3S)-3-methylhexanediperoxoate.
| Compound Name | bis[6-[2-[6-[4-(4-cyanophenyl)phenoxy]hexoxy]phenoxy]hexyl] (3S)-3-methylhexanediperoxoate |
|---|---|
| PubChem CID | 102413908 |
| Molecular Formula | C69H82N2O12 |
| Molecular Weight | 1131.42 g/mol |
| Exact Mass | 1130.59 |
| IUPAC Name | bis[6-[2-[6-[4-(4-cyanophenyl)phenoxy]hexoxy]phenoxy]hexyl] (3S)-3-methylhexanediperoxoate |
| SMILES | C[C@@H](CCC(=O)OOCCCCCCOc1ccccc1OCCCCCCOc1ccc(-c2ccc(C#N)cc2)cc1)CC(=O)OOCCCCCCOc1ccccc1OCCCCCCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C69H82N2O12/c1-55(52-69(73)83-81-51-21-9-7-19-49-79-67-25-13-11-23-65(67)77-47-17-5-3-15-45-75-63-41-37-61(38-42-63)59-33-29-57(54-71)30-34-59)26-43-68(72)82-80-50-20-8-6-18-48-78-66-24-12-10-22-64(66)76-46-16-4-2-14-44-74-62-39-35-60(36-40-62)58-31-27-56(53-70)28-32-58/h10-13,22-25,27-42,55H,2-9,14-21,26,43-52H2,1H3/t55-/m0/s1 |
| InChIKey | UWYJBKLBUKCCCZ-GNFJTHHVSA-N |
| XLogP | 16.13 |
| TPSA | 174.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1131.42 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|