C8H10N3+ — CID 102414366
4-cyclopenta-1,3-dien-1-yl-1-methyl-1,2,4-triazol-4-ium (PubChem CID 102414366) has the molecular formula C8H10N3+ and a molecular weight of 148.19 g/mol. Its IUPAC name is 4-cyclopenta-1,3-dien-1-yl-1-methyl-1,2,4-triazol-4-ium.
| Compound Name | 4-cyclopenta-1,3-dien-1-yl-1-methyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 102414366 |
| Molecular Formula | C8H10N3+ |
| Molecular Weight | 148.19 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 4-cyclopenta-1,3-dien-1-yl-1-methyl-1,2,4-triazol-4-ium |
| SMILES | Cn1c[n+](C2=CC=CC2)cn1 |
| InChI | InChI=1S/C8H10N3/c1-10-7-11(6-9-10)8-4-2-3-5-8/h2-4,6-7H,5H2,1H3/q+1 |
| InChIKey | DOLOGGIWPOJVFY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|