C9H14N4 — CID 143400028
(2E,4Z)-4-(1,2,4-triazol-4-ylmethyl)hexa-2,4-dien-3-amine (PubChem CID 143400028) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is (2E,4Z)-4-(1,2,4-triazol-4-ylmethyl)hexa-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-4-(1,2,4-triazol-4-ylmethyl)hexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 143400028 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (2E,4Z)-4-(1,2,4-triazol-4-ylmethyl)hexa-2,4-dien-3-amine |
| SMILES | C/C=C(Cn1cnnc1)\C(N)=C/C |
| InChI | InChI=1S/C9H14N4/c1-3-8(9(10)4-2)5-13-6-11-12-7-13/h3-4,6-7H,5,10H2,1-2H3/b8-3-,9-4+ |
| InChIKey | FZSUMWHWMVAQIY-SNXNNQDSSA-N |
| XLogP | 1.09 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|