C15H18N2O5 — CID 102414735
cis-(2R,4R)-4-methyl-2-[(1S)-2-nitro-1-(2-nitrophenyl)ethyl]cyclohexan-1-one (PubChem CID 102414735) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is cis-(2R,4R)-4-methyl-2-[(1S)-2-nitro-1-(2-nitrophenyl)ethyl]cyclohexan-1-one.
| Compound Name | cis-(2R,4R)-4-methyl-2-[(1S)-2-nitro-1-(2-nitrophenyl)ethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102414735 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | cis-(2R,4R)-4-methyl-2-[(1S)-2-nitro-1-(2-nitrophenyl)ethyl]cyclohexan-1-one |
| SMILES | C[C@@H]1CCC(=O)[C@@H]([C@H](C[N+](=O)[O-])c2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H18N2O5/c1-10-6-7-15(18)12(8-10)13(9-16(19)20)11-4-2-3-5-14(11)17(21)22/h2-5,10,12-13H,6-9H2,1H3/t10-,12-,13-/m1/s1 |
| InChIKey | NGQSXHXDCCJWPN-RAIGVLPGSA-N |
| XLogP | 2.96 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|