C10H12BrN3OS — CID 102417219
6-amino-2-bromo-3-(3,4-dimethyl-2H-1,3-thiazol-2-yl)-1H-pyridin-4-one (PubChem CID 102417219) has the molecular formula C10H12BrN3OS and a molecular weight of 302.20 g/mol. Its IUPAC name is 6-amino-2-bromo-3-(3,4-dimethyl-2H-1,3-thiazol-2-yl)-1H-pyridin-4-one.
| Compound Name | 6-amino-2-bromo-3-(3,4-dimethyl-2H-1,3-thiazol-2-yl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 102417219 |
| Molecular Formula | C10H12BrN3OS |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 6-amino-2-bromo-3-(3,4-dimethyl-2H-1,3-thiazol-2-yl)-1H-pyridin-4-one |
| SMILES | CC1=CSC(c2c(Br)[nH]c(N)cc2=O)N1C |
| InChI | InChI=1S/C10H12BrN3OS/c1-5-4-16-10(14(5)2)8-6(15)3-7(12)13-9(8)11/h3-4,10H,1-2H3,(H3,12,13,15) |
| InChIKey | LKTOGLTZZGQOME-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|