C27H24N2O2 — CID 102417948
ethyl 4-(2-benzyl-4,5-dihydrobenzo[g]indazol-3-yl)benzoate (PubChem CID 102417948) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is ethyl 4-(2-benzyl-4,5-dihydrobenzo[g]indazol-3-yl)benzoate.
| Compound Name | ethyl 4-(2-benzyl-4,5-dihydrobenzo[g]indazol-3-yl)benzoate |
|---|---|
| PubChem CID | 102417948 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | ethyl 4-(2-benzyl-4,5-dihydrobenzo[g]indazol-3-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c3c(nn2Cc2ccccc2)-c2ccccc2CC3)cc1 |
| InChI | InChI=1S/C27H24N2O2/c1-2-31-27(30)22-14-12-21(13-15-22)26-24-17-16-20-10-6-7-11-23(20)25(24)28-29(26)18-19-8-4-3-5-9-19/h3-15H,2,16-18H2,1H3 |
| InChIKey | WLXKYSQNVTWTGT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |