About ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate
ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate (PubChem CID 70031378) has the molecular formula C20H20N2O2S
and a molecular weight of 352.46 g/mol. Its IUPAC name is ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate |
| PubChem CID | 70031378 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate |
| SMILES | CCOC(=O)c1sc(C)c2c1CCc1cnn(Cc3ccccc3)c1-2 |
| InChI | InChI=1S/C20H20N2O2S/c1-3-24-20(23)19-16-10-9-15-11-21-22(12-14-7-5-4-6-8-14)18(15)17(16)13(2)25-19/h4-8,11H,3,9-10,12H2,1-2H3 |
| InChIKey | OAJHUVCASCLCKS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate?
The IUPAC name of ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate (CID 70031378) is ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate.
What is the SMILES notation for ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate?
The canonical SMILES for ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate is CCOC(=O)c1sc(C)c2c1CCc1cnn(Cc3ccccc3)c1-2.
What is the InChIKey of ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate?
The InChIKey is OAJHUVCASCLCKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2S/c1-3-24-20(23)19-16-10-9-15-11-21-22(12-14-7-5-4-6-8-14)18(15)17(16)13(2)25-19/h4-8,11H,3,9-10,12H2,1-2H3.
What are the key properties of ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate?
ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate has a molecular weight of 352.46 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzyl-8-methyl-4,5-dihydrothieno[3,4-g]indazole-6-carboxylate is sourced from PubChem (CID 70031378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).