C24H31NO4 — CID 102419285
tert-butyl (3R,5aR,9aR,10S,10aR)-10-ethyl-5-oxo-3-phenyl-3,6,7,9a,10,10a-hexahydro-2H-[1,3]oxazolo[3,2-b]isoquinoline-5a-carboxylate (PubChem CID 102419285) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl (3R,5aR,9aR,10S,10aR)-10-ethyl-5-oxo-3-phenyl-3,6,7,9a,10,10a-hexahydro-2H-[1,3]oxazolo[3,2-b]isoquinoline-5a-carboxylate.
| Compound Name | tert-butyl (3R,5aR,9aR,10S,10aR)-10-ethyl-5-oxo-3-phenyl-3,6,7,9a,10,10a-hexahydro-2H-[1,3]oxazolo[3,2-b]isoquinoline-5a-carboxylate |
|---|---|
| PubChem CID | 102419285 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | tert-butyl (3R,5aR,9aR,10S,10aR)-10-ethyl-5-oxo-3-phenyl-3,6,7,9a,10,10a-hexahydro-2H-[1,3]oxazolo[3,2-b]isoquinoline-5a-carboxylate |
| SMILES | CC[C@@H]1[C@H]2OC[C@@H](c3ccccc3)N2C(=O)[C@@]2(C(=O)OC(C)(C)C)CCC=C[C@H]12 |
| InChI | InChI=1S/C24H31NO4/c1-5-17-18-13-9-10-14-24(18,22(27)29-23(2,3)4)21(26)25-19(15-28-20(17)25)16-11-7-6-8-12-16/h6-9,11-13,17-20H,5,10,14-15H2,1-4H3/t17-,18+,19-,20+,24+/m0/s1 |
| InChIKey | LCEVHZDYMAOWHX-JKNYOYKWSA-N |
| XLogP | 4.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|