C30H34N2O5 — CID 53349177
tert-butyl (3R,6R,7R,8S,8aR)-8-ethyl-7-[2-(1H-indol-2-yl)-2-oxoethyl]-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate (PubChem CID 53349177) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is tert-butyl (3R,6R,7R,8S,8aR)-8-ethyl-7-[2-(1H-indol-2-yl)-2-oxoethyl]-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate.
| Compound Name | tert-butyl (3R,6R,7R,8S,8aR)-8-ethyl-7-[2-(1H-indol-2-yl)-2-oxoethyl]-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 53349177 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | tert-butyl (3R,6R,7R,8S,8aR)-8-ethyl-7-[2-(1H-indol-2-yl)-2-oxoethyl]-5-oxo-3-phenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine-6-carboxylate |
| SMILES | CC[C@H]1[C@@H](CC(=O)c2cc3ccccc3[nH]2)[C@@H](C(=O)OC(C)(C)C)C(=O)N2[C@@H]1OC[C@H]2c1ccccc1 |
| InChI | InChI=1S/C30H34N2O5/c1-5-20-21(16-25(33)23-15-19-13-9-10-14-22(19)31-23)26(29(35)37-30(2,3)4)27(34)32-24(17-36-28(20)32)18-11-7-6-8-12-18/h6-15,20-21,24,26,28,31H,5,16-17H2,1-4H3/t20-,21+,24-,26+,28+/m0/s1 |
| InChIKey | CHMLZFFUDKWCAN-GQWURFEHSA-N |
| XLogP | 5.28 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|