C15H25N4O4P — CID 102420550
(1S,2S)-3-azido-1-diethoxyphosphoryl-2-[[(1R)-1-phenylethyl]amino]propan-1-ol (PubChem CID 102420550) has the molecular formula C15H25N4O4P and a molecular weight of 356.36 g/mol. Its IUPAC name is (1S,2S)-3-azido-1-diethoxyphosphoryl-2-[[(1R)-1-phenylethyl]amino]propan-1-ol.
| Compound Name | (1S,2S)-3-azido-1-diethoxyphosphoryl-2-[[(1R)-1-phenylethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 102420550 |
| Molecular Formula | C15H25N4O4P |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1S,2S)-3-azido-1-diethoxyphosphoryl-2-[[(1R)-1-phenylethyl]amino]propan-1-ol |
| SMILES | CCOP(=O)(OCC)[C@H](O)[C@H](CN=[N+]=[N-])N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H25N4O4P/c1-4-22-24(21,23-5-2)15(20)14(11-17-19-16)18-12(3)13-9-7-6-8-10-13/h6-10,12,14-15,18,20H,4-5,11H2,1-3H3/t12-,14+,15+/m1/s1 |
| InChIKey | KVLDXLLKKZZWJJ-SNPRPXQTSA-N |
| XLogP | 3.60 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|